
CAS 30813-84-4
:Pyrogallol polymer
Description:
Pyrogallol polymer, with the CAS number 30813-84-4, is a polymer derived from the oxidative polymerization of pyrogallol, a tri-hydroxy phenolic compound. This substance is characterized by its dark brown to black color and is known for its high solubility in water and organic solvents. Pyrogallol polymer exhibits antioxidant properties, making it useful in various applications, including as a reducing agent in chemical reactions and as a stabilizer in photographic processes. Its structure consists of repeating units that contribute to its unique chemical properties, including the ability to form complexes with metal ions. Additionally, pyrogallol polymer can be utilized in the formulation of dyes, inks, and coatings due to its ability to enhance color stability and improve adhesion. The material's reactivity and functional groups also allow for further chemical modifications, expanding its potential applications in fields such as pharmaceuticals and materials science. Overall, pyrogallol polymer is valued for its versatility and functional characteristics in various industrial applications.
Formula:(C6H6O3)x
InChI:InChI=1S/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H
InChI key:InChIKey=WQGWDDDVZFFDIG-UHFFFAOYSA-N
SMILES:OC1=C(O)C=CC=C1O
Synonyms:- 1,2,3-Benzenetriol, homopolymer
- Pyrogallol polymer
- Pyrogallol, polymers
- Polypyrogallol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
