CAS 3082-69-7
:Ethyl (βS)-β-aminobenzenepropanoate
Description:
Ethyl (βS)-β-aminobenzenepropanoate, also known by its CAS number 3082-69-7, is an organic compound characterized by its ester functional group and an amino group attached to a benzene ring. This compound features a propanoate backbone, where the ethyl group is esterified to the carboxylic acid part of the molecule. The presence of the amino group introduces basic properties and potential for hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature are utilized in various chemical syntheses and may serve as intermediates in the production of pharmaceuticals or agrochemicals. The stereochemistry indicated by the (βS) designation suggests a specific spatial arrangement of atoms, which can significantly affect the compound's biological activity and interactions. Ethyl (βS)-β-aminobenzenepropanoate may exhibit moderate to high polarity due to the combination of its functional groups, impacting its behavior in different solvents and environments. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry contexts.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-2-14-11(13)8-10(12)9-6-4-3-5-7-9/h3-7,10H,2,8,12H2,1H3/t10-/m0/s1
InChI key:InChIKey=NUWRDXMXYDWUAN-JTQLQIEISA-N
SMILES:[C@@H](CC(OCC)=O)(N)C1=CC=CC=C1
Synonyms:- (S)-Ethyl 3-amino-3-phenylpropionate
- (S)-Ethyl3-amino-3-phenylpropionate
- Benzenepropanoic acid, β-amino-, ethyl ester, (S)-
- Benzenepropanoicacid, b-amino-, ethyl ester, (S)-
- Ethyl (3S)-3-amino-3-phenylpropanoate
- Ethyl (βS)-β-aminobenzenepropanoate
- Ethyl(S)-3-amino-3-phenylpropanoate
- Hydrocinnamic acid, b-amino-, ethyl ester, (S)-(+)- (8CI)
- Hydrocinnamic acid, β-amino-, ethyl ester, (S)-(+)-
- Benzenepropanoic acid, β-amino-, ethyl ester, (βS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(betaS)-β-Aminobenzenepropanoic Acid Ethyl Ester
CAS:Controlled ProductFormula:C11H15NO2Color and Shape:NeatMolecular weight:193.242

