CymitQuimica logo

CAS 308239-37-4

:

4-Chlorobenzoic acid 2-[(dimethylamino)methylene]hydrazide

Description:
4-Chlorobenzoic acid 2-[(dimethylamino)methylene]hydrazide is a chemical compound characterized by its hydrazide functional group, which is linked to a chlorobenzoic acid moiety. This compound typically exhibits properties associated with both hydrazides and aromatic carboxylic acids, including potential solubility in polar solvents due to the presence of the hydrazide group. The chlorobenzoic acid component contributes to its reactivity, particularly in nucleophilic substitution reactions. The dimethylamino group enhances its basicity and may influence its interaction with biological systems, potentially exhibiting pharmacological activity. Additionally, the presence of the chlorine atom can affect the compound's electronic properties and steric hindrance, which may play a role in its reactivity and stability. Overall, this compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C10H12ClN3O
InChI:InChI=1S/C10H12ClN3O/c1-14(2)7-12-13-10(15)8-3-5-9(11)6-4-8/h3-7H,1-2H3,(H,13,15)
InChI key:InChIKey=WMRZQKCVTKPZEO-UHFFFAOYSA-N
SMILES:C(NN=CN(C)C)(=O)C1=CC=C(Cl)C=C1
Synonyms:
  • Benzoic acid, 4-chloro-, 2-[(dimethylamino)methylene]hydrazide
  • Benzoic acid, 4-chloro-, [(dimethylamino)methylene]hydrazide
  • 4-Chlorobenzoic acid 2-[(dimethylamino)methylene]hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.