CAS 30824-21-6
:methyl (3S,4S,5S,6S)-6-(4-acetamidophenoxy)-3,4,5-triacetoxy-tetrahydropyran-2-carboxylate
Description:
Methyl (3S,4S,5S,6S)-6-(4-acetamidophenoxy)-3,4,5-triacetoxy-tetrahydropyran-2-carboxylate, with the CAS number 30824-21-6, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple acetoxy groups, contributing to its reactivity and solubility in organic solvents. The presence of the acetamidophenoxy moiety indicates potential biological activity, as phenolic compounds often exhibit various pharmacological properties. The stereochemistry denoted by the (3S,4S,5S,6S) configuration suggests specific spatial arrangements of the substituents, which can influence the compound's interactions with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural complexity and potential therapeutic applications. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in organic synthesis and pharmacology.
Formula:C21H25NO11
InChI:InChI=1/C21H25NO11/c1-10(23)22-14-6-8-15(9-7-14)32-21-19(31-13(4)26)17(30-12(3)25)16(29-11(2)24)18(33-21)20(27)28-5/h6-9,16-19,21H,1-5H3,(H,22,23)/t16-,17-,18?,19-,21+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Acetamidophenyl-2,3,4-tri-O-acetyl-β-D-glucuronide methyl ester
CAS:Formula:C21H25NO11Color and Shape:SolidMolecular weight:467.42334-Acetamidophenyl-2,3,4-tri-O-acetyl-β-D-glucuronide methyl ester
CAS:<p>4-Acetamidophenyl-2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester is a modified sugar with a saccharide at the 2' position and an acetamidophenol group at the 4' position. It can be used in a variety of synthetic methods, such as the Click modification and glycosylation. This product is custom synthesized and has high purity, making it a good choice for many research applications.</p>Formula:C21H25NO11Purity:Min. 95%Molecular weight:467.42 g/mol


