CAS 308273-67-8

(1S)-N-(3,4-dimethoxybenzyl)-1-phenylethanaminium

Description:

(1S)-N-(3,4-dimethoxybenzyl)-1-phenylethanaminium, with the CAS number 308273-67-8, is a chemical compound characterized by its quaternary ammonium structure, which includes a phenylethanaminium core. This compound features a chiral center, indicated by the (1S) configuration, which can influence its biological activity and interactions. The presence of the 3,4-dimethoxybenzyl group contributes to its lipophilicity and potential for binding to various biological targets. Typically, such compounds may exhibit properties relevant to pharmacology, including potential roles as neurotransmitter modulators or in other therapeutic applications. The methoxy groups enhance the electron-donating capacity of the aromatic ring, potentially affecting the compound's reactivity and solubility. Additionally, the quaternary ammonium nature suggests that it may be positively charged at physiological pH, influencing its transport and interaction with cellular membranes. Overall, this compound's unique structural features may lead to diverse applications in medicinal chemistry and drug development.

Formula: C₁₇H₂₂NO₂

InChI: InChI=1/C17H21NO2/c1-13(15-7-5-4-6-8-15)18-12-14-9-10-16(19-2)17(11-14)20-3/h4-11,13,18H,12H2,1-3H3/p+1/t13-/m0/s1

(-)-(S)-N-(3,4-Dimethoxybenzyl)-(1-phenylethyl)amine

CAS: 308273-67-8

Formula: C₁₇H₂₁NO₂

Molecular weight: 271.3541

Ref: IN-DA0031F5

Cinacalcet Impurity 79 HCl

CAS: 308273-67-8

Formula: C₁₇H₂₁NO₂·HCl

Molecular weight: 271.36 36.46

Ref: 4Z-C-4090

(S)-N-(3,4-Dimethoxybenzyl)-1-phenylethanamine

CAS: 308273-67-8

Formula: C₁₇H₂₁NO₂

Purity: 95.0%

Molecular weight: 271.36

Ref: 10-F320263