CymitQuimica logo

CAS 308357-14-4

:

5-tert-butoxy-4-(tert-butoxycarbonyl)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-oxopentanoic acid (non-preferred name)

Description:
5-tert-butoxy-4-(tert-butoxycarbonyl)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-oxopentanoic acid, identified by its CAS number 308357-14-4, is a complex organic compound characterized by multiple functional groups that contribute to its chemical properties. It features a pentanoic acid backbone with tert-butoxy and tert-butoxycarbonyl groups, which enhance its stability and solubility in organic solvents. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates its utility in peptide synthesis, particularly in protecting amino acids during the formation of peptide bonds. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic tert-butyl groups and polar functional groups. Its structure suggests potential applications in pharmaceutical chemistry, particularly in drug design and synthesis. Additionally, the compound's stability under various conditions makes it suitable for use in organic synthesis and bioconjugation reactions. Overall, its unique structural features and functional versatility make it a valuable compound in chemical research and development.
Formula:C29H35NO8
InChI:InChI=1/C29H35NO8/c1-28(2,3)37-25(33)21(26(34)38-29(4,5)6)15-23(24(31)32)30-27(35)36-16-22-19-13-9-7-11-17(19)18-12-8-10-14-20(18)22/h7-14,21-23H,15-16H2,1-6H3,(H,30,35)(H,31,32)
SMILES:CC(C)(C)OC(=O)C(CC(C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)C(=O)OC(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.