CAS 3084-48-8
:Trihexylphosphine oxide
Description:
Trihexylphosphine oxide, with the CAS number 3084-48-8, is an organophosphorus compound characterized by its phosphine oxide functional group. It typically appears as a colorless to pale yellow liquid and is known for its high boiling point and low volatility. This compound is soluble in organic solvents such as alcohols and ethers, but it has limited solubility in water. Trihexylphosphine oxide is often utilized as a ligand in coordination chemistry and catalysis, as well as in the extraction of metal ions due to its ability to form stable complexes. Its structure features three hexyl groups attached to a phosphorus atom, which contributes to its hydrophobic nature and enhances its effectiveness in various chemical applications. Additionally, it exhibits properties such as thermal stability and resistance to oxidation, making it suitable for use in diverse chemical environments. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C18H39OP
InChI:InChI=1S/C18H39OP/c1-4-7-10-13-16-20(19,17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3
InChI key:InChIKey=PPDZLUVUQQGIOJ-UHFFFAOYSA-N
SMILES:P(CCCCCC)(CCCCCC)(CCCCCC)=O
Synonyms:- Phosphine oxide, trihexyl-
- NSC 41936
- 1-Dihexylphosphorylhexane
- Trihexylphosphine oxide
- Tri-n-hexylphosphine oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
