CAS 3084-53-5: Sulfonium, trimethyl-, bromide (1:1)
Description:Trimethylsulfonium bromide, with the CAS number 3084-53-5, is a quaternary ammonium salt characterized by the presence of a positively charged trimethylsulfonium ion and a bromide anion. This compound typically appears as a white crystalline solid and is soluble in polar solvents such as water and alcohols. It is known for its role as a reagent in organic synthesis, particularly in the formation of sulfonium salts and as a methylating agent. The trimethylsulfonium group imparts unique properties, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, trimethylsulfonium bromide can serve as a source of the trimethylsulfonium ion, which is valuable in the synthesis of other organic compounds. Safety data indicates that, like many quaternary ammonium compounds, it should be handled with care due to potential irritant properties. Overall, trimethylsulfonium bromide is a versatile compound in synthetic organic chemistry, contributing to the development of various chemical processes.
Formula:C3H9S·Br
InChI:InChI=1S/C3H9S.BrH/c1-4(2)3;/h1-3H3;1H/q+1;/p-1
InChI key:InChIKey=GOTIICCWNAPLMN-UHFFFAOYSA-M
SMILES:[Br-].[S+](C)(C)C
- Synonyms:
- Sulfonium, trimethyl-, bromide
- Sulfonium, trimethyl-, bromide (1:1)
- Trimethyl-sulfoniubromide
- Trimethylsulfonium
- Trimethylsulfonium bromide
- Trimethylsulphonium bromide
Trimethylsulfonium Bromide
Ref: 3B-T1771
| 25g | 43.00 € | ||
| 100g | 99.00 € |
Trimethylsulfonium bromide, 98%
Ref: 02-B25098
| 25g | To inquire | ||
| 100g | 197.00 € | ||
| 500g | 800.00 € |
Sulfonium, trimethyl-, bromide (1:1)
Ref: IN-DA0031HE
| 5g | To inquire | ||
| 25g | 26.00 € | ||
| 100g | 27.00 € | ||
| 500g | 65.00 € |
Ref: 54-OR95378
| 5g | 32.00 € | ||
| 25g | 36.00 € | ||
| 100g | 44.00 € | ||
| 25kg | 2,538.00 € | ||
| 500g | 76.00 € | ||
| 2.5kg | 298.00 € |
Trimethylsulfonium bromide
Ref: 3D-DAA08453
| 500g | Discontinued | Request information |
