CAS 30861-27-9: Aloesin
Description:Aloesin is a natural compound primarily derived from the aloe vera plant, specifically from its leaves. It is classified as a chromone glycoside, which means it contains a chromone structure linked to a sugar moiety. Aloesin is known for its potential therapeutic properties, including anti-inflammatory, antioxidant, and skin-protective effects. It has been studied for its ability to inhibit the enzyme tyrosinase, which plays a crucial role in melanin production, making it of interest in cosmetic applications for skin lightening. Additionally, aloenin exhibits antimicrobial properties, contributing to its use in traditional medicine. The compound is generally recognized as safe for topical use, although further research is needed to fully understand its mechanisms and efficacy. Its solubility characteristics and stability can vary depending on the formulation and conditions, which is important for its application in various products. Overall, aloenin represents a valuable bioactive compound with diverse applications in health and skincare.
Formula:C19H22O9
InChI:InChI=1S/C19H22O9/c1-7-3-10(22)14(19-17(26)16(25)15(24)12(6-20)28-19)18-13(7)11(23)5-9(27-18)4-8(2)21/h3,5,12,15-17,19-20,22,24-26H,4,6H2,1-2H3/t12-,15-,16+,17-,19+/m1/s1
InChI key:InChIKey=HKIKAXXIWJHWLY-ZIIYPAMZSA-N
SMILES:O=C1C=C(OC2=C1C(=CC(O)=C2C3OC(CO)C(O)C(O)C3O)C)CC(=O)C
- Synonyms:
- (1R)-1,5-anhydro-1-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)-4H-chromen-8-yl]glucitol
- 4H-1-Benzopyran-4-one, 8-β-<span class="text-smallcaps">D</span>-glucopyranosyl-7-hydroxy-5-methyl-2-(2-oxopropyl)-
- 8-β-<span class="text-smallcaps">D</span>-Glucopyranosyl-7-hydroxy-5-methyl-2-(2-oxopropyl)-4H-1-benzopyran-4-one
- Aloe resin B
- Aloeresin
- Aloesin
- D-glucitol, 1,5-anhydro-1-C-[7-hydroxy-5-methyl-4-oxo-2-(2-oxopropyl)-4H-1-benzopyran-8-yl]-, (1R)-
- 8-β-D-Glucopyranosyl-7-hydroxy-5-methyl-2-(2-oxopropyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 8-β-D-glucopyranosyl-7-hydroxy-5-methyl-2-(2-oxopropyl)-
