CAS 3087-01-2
:8-methyl-8-azabicyclo[3.2.1]oct-3-yl phenylacetate hydrochloride (1:1)
Description:
8-Methyl-8-azabicyclo[3.2.1]oct-3-yl phenylacetate hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, making it a member of the azabicyclic class. The compound features a phenylacetate moiety, contributing to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its hydrochloride salt form indicates that it is a hydrochloride, which enhances its solubility in water and may influence its pharmacokinetic properties. The presence of the methyl group at the 8-position of the bicyclic framework can affect the compound's steric and electronic properties, potentially impacting its biological activity. As with many compounds in this class, it may exhibit interesting interactions with biological targets, making it a subject of interest for further research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C16H22ClNO2
InChI:InChI=1/C16H21NO2.ClH/c1-17-13-7-8-14(17)11-15(10-13)19-16(18)9-12-5-3-2-4-6-12;/h2-6,13-15H,7-11H2,1H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

