CymitQuimica logo

CAS 308796-47-6

:

(2E)-3-(~2~H_5_)phenyl(3-~2~H)prop-2-enoic acid

Description:
The chemical substance known as (2E)-3-(2H5)phenyl(3-2H)prop-2-enoic acid, with the CAS number 308796-47-6, is an organic compound characterized by its structure, which features a phenyl group attached to a prop-2-enoic acid backbone. This compound exhibits properties typical of unsaturated carboxylic acids, including the presence of a double bond between the second and third carbon atoms of the propene chain. The deuterated labels (2H5 and 2H) indicate that certain hydrogen atoms in the molecule are replaced with deuterium, which can influence its physical and chemical properties, such as stability and reactivity. The presence of the phenyl group contributes to its aromatic characteristics, potentially affecting its solubility and interaction with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique isotopic composition and structural features. Its applications could range from research in drug development to studies in chemical synthesis and reaction mechanisms.
Formula:C9H2D6O2
InChI:InChI=1/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+/i1D,2D,3D,4D,5D,6D
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.