CAS 308815-81-8

methyl 2-[4-(hydroxymethyl)-2-nitro-phenoxy]acetate

Description:

Methyl 2-[4-(hydroxymethyl)-2-nitro-phenoxy]acetate, identified by its CAS number 308815-81-8, is an organic compound characterized by its ester functional group and the presence of both nitro and hydroxymethyl substituents on the aromatic ring. This compound typically exhibits moderate polarity due to the presence of the hydroxymethyl and nitro groups, which can influence its solubility in various solvents. The nitro group is known for its electron-withdrawing properties, which can affect the reactivity of the compound in chemical reactions. Additionally, the ester group contributes to its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, and it may undergo hydrolysis under certain conditions. Overall, methyl 2-[4-(hydroxymethyl)-2-nitro-phenoxy]acetate is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₀H₁₁NO₆

InChI: InChI=1/C10H11NO6/c1-16-10(13)6-17-9-3-2-7(5-12)4-8(9)11(14)15/h2-4,12H,5-6H2,1H3

SMILES: COC(=O)COc1ccc(cc1N(=O)=O)CO

Synonyms:

• Methyl [4-(hydroxymethyl)-2-nitrophenoxy]acetate

2-[4-(Hydroxymethyl)-2-nitrophenoxy]acetic acid methyl ester

CAS: 308815-81-8

Formula: C₁₀H₁₁NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 241.1974

Ref: IN-DA0031KH

Methyl 2-(4-(hydroxymethyl)-2-nitrophenoxy)acetate

CAS: 308815-81-8

Purity: 98%

Molecular weight: 241.1990051

Ref: 10-F772706