CymitQuimica logo

CAS 308846-06-2

:

2-Cyano-5-bromomethylpyridine

Description:
2-Cyano-5-bromomethylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a cyano group (-C≡N) at the 2-position and a bromomethyl group (-CH2Br) at the 5-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its polar nature due to the cyano group, which can engage in hydrogen bonding and dipole interactions. Its bromomethyl substituent can serve as a versatile electrophile in nucleophilic substitution reactions, making it useful in the synthesis of various derivatives. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed. Overall, 2-Cyano-5-bromomethylpyridine is a valuable intermediate in chemical research and development.
Formula:C7H5BrN2
InChI:InChI=1/C7H5BrN2/c8-3-6-1-2-7(4-9)10-5-6/h1-2,5H,3H2
InChI key:VEPVNICICSNYPW-UHFFFAOYSA-N
SMILES:c1cc(C#N)ncc1CBr
Synonyms:
  • 5-(Bromomethyl)pyridine-2-carbonitrile
Found 4 products.