CAS 30892-86-5
:bradykinin potentiator B
Description:
Bradykinin potentiator B (CAS 30892-86-5) is a peptide that is primarily known for its role in enhancing the effects of bradykinin, a potent vasodilator involved in various physiological processes, including inflammation and pain modulation. This substance is derived from the venom of certain species of snakes, particularly the Bothrops genus. Its structure typically consists of a sequence of amino acids that contribute to its biological activity. Bradykinin potentiator B functions by inhibiting the enzyme that degrades bradykinin, thereby prolonging its action in the body. This characteristic makes it of interest in pharmacological research, particularly in the development of new therapeutic agents for conditions related to cardiovascular health and pain management. Additionally, due to its origin, it may exhibit specific interactions with biological systems that are unique to its peptide nature. Overall, bradykinin potentiator B represents a fascinating example of how natural compounds can influence biochemical pathways and potentially lead to novel medical applications.
Formula:C56H91N15O13
InChI:InChI=1/C56H91N15O13/c1-5-33(4)45(54(82)70-28-12-19-41(70)53(81)71-29-13-20-42(71)55(83)84)66-47(75)34(14-6-7-23-57)64-48(76)38-16-9-25-67(38)50(78)36(15-8-24-60-56(58)59)65-49(77)39-17-10-26-68(39)52(80)40-18-11-27-69(40)51(79)37(30-32(2)3)63-44(73)31-61-46(74)35-21-22-43(72)62-35/h32-42,45H,5-31,57H2,1-4H3,(H,61,74)(H,62,72)(H,63,73)(H,64,76)(H,65,77)(H,66,75)(H,83,84)(H4,58,59,60)
SMILES:CCC(C)C(C(=O)N1CCCC1C(=O)N1CCCC1C(=O)O)N=C(C(CCCCN)N=C(C1CCCN1C(=O)C(CCCNC(=N)N)N=C(C1CCCN1C(=O)C1CCCN1C(=O)C(CC(C)C)N=C(CN=C(C1CCC(=N1)O)O)O)O)O)O
Synonyms:- Pyr-Gly-Leu-Pro-Pro-Arg-Pro-Lys-Ile-Pro-Pro-OH
- 5-oxoprolylglycylleucylprolylprolyl-N~5~-(diaminomethylidene)ornithylprolyllysylisoleucylprolylproline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Bradykinin-Potentiator B
CAS:Bradykinin-potentiator B is a peptide that belongs to the group of activators. It has been shown to activate ion channels and is used as a research tool for studying protein interactions, receptor pharmacology, and ligand binding. Bradykinin-potentiator B can be used in cell biology for studying protein interactions with antibodies or receptors. Bradykinin potentiator B binds to the receptor site and activates it by changing its conformation. This leads to changes in the cell's behavior, such as increased secretion of hormones or neurotransmitters.
Formula:C56H91N15O13Purity:Min. 95%Molecular weight:1,182.4 g/mol
