CAS 30897-86-0
:2,5-dimethylphenylmagnesium bromide
Description:
2,5-Dimethylphenylmagnesium bromide is a Grignard reagent, characterized by its organomagnesium structure, which includes a phenyl group substituted with two methyl groups at the 2 and 5 positions. This compound is typically a colorless to light yellow solid or solution, known for its reactivity, particularly with electrophiles, due to the presence of the highly nucleophilic carbon-magnesium bond. It is soluble in organic solvents like diethyl ether and tetrahydrofuran, but reacts vigorously with water and moisture, releasing hydrocarbons and forming magnesium hydroxide. The compound is used in organic synthesis for the formation of carbon-carbon bonds, enabling the construction of complex molecules. Safety precautions are essential when handling this reagent, as it is flammable and can cause severe chemical burns. Proper storage in an inert atmosphere is recommended to maintain its stability and reactivity. Overall, 2,5-dimethylphenylmagnesium bromide is a valuable tool in synthetic organic chemistry, facilitating various transformations and the synthesis of diverse organic compounds.
Formula:C8H9BrMg
InChI:InChI=1/C8H9.BrH.Mg/c1-7-3-5-8(2)6-4-7;;/h3-5H,1-2H3;1H;/q;;+1/p-1/rC8H9BrMg/c1-6-3-4-7(2)8(5-6)10-9/h3-5H,1-2H3
SMILES:CC1C=CC(=C=C1)C.Br.[Mg]
Synonyms:- Bromo(2,5-dimethylphenyl)magnesium
- Magnesium, Bromo(2,5-Dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Magnesium, bromo(2,5-dimethylphenyl)-
CAS:Formula:C8H9BrMgColor and Shape:LiquidMolecular weight:209.3661
