CAS 30902-36-4

(4E)-3-hydroxy-4-imino-1-pentofuranosyl-3,4-dihydropyrimidin-2(1H)-one

Description:

(4E)-3-hydroxy-4-imino-1-pentofuranosyl-3,4-dihydropyrimidin-2(1H)-one, with the CAS number 30902-36-4, is a chemical compound that exhibits characteristics typical of nucleoside analogs. This substance features a furanosyl sugar moiety linked to a dihydropyrimidinone structure, which contributes to its potential biological activity. The presence of a hydroxyl group and an imino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The compound's structural configuration indicates that it may interact with biological macromolecules, such as nucleic acids or proteins, potentially affecting cellular processes. Its unique arrangement of functional groups may also confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its application and study. Overall, this compound represents a fascinating area of research within the field of organic and medicinal chemistry.

Formula: C₉H₁₃N₃O₆

InChI: InChI=1/C9H13N3O6/c10-5-1-2-11(9(16)12(5)17)8-7(15)6(14)4(3-13)18-8/h1-2,4,6-8,10,13-15,17H,3H2/b10-5+

Cytarabine Impurity 13

CAS: 30902-36-4

Formula: C₉H₁₃N₃O₆

Molecular weight: 259.218

Ref: 4Z-C-150021

Cytarabine-N-Oxide

Controlled Product

CAS: 30902-36-4

Formula: C₉H₁₃N₃O₆

Color and Shape: Neat

Molecular weight: 259.216

Ref: TR-C410130