CAS 3091-25-6
:Octyltin trichloride
Description:
Octyltin trichloride, with the CAS number 3091-25-6, is an organotin compound characterized by its octyl group attached to a tin atom, which is further coordinated to three chlorine atoms. This compound typically appears as a colorless to pale yellow liquid and is known for its high stability and low volatility. Octyltin trichloride is primarily used as a precursor in the synthesis of other organotin compounds and as a catalyst in various chemical reactions, particularly in polymer production. It exhibits hydrophobic properties due to the long hydrocarbon chain, making it useful in applications that require water resistance. However, it is important to note that organotin compounds, including octyltin trichloride, can be toxic and pose environmental hazards, particularly to aquatic life. Therefore, handling this substance requires appropriate safety measures to mitigate exposure risks. Its chemical behavior is influenced by the presence of the tin-chlorine bonds, which can undergo hydrolysis in the presence of moisture, leading to the formation of other tin species.
Formula:C8H17Cl3Sn
InChI:InChI=1S/C8H17.3ClH.Sn/c1-3-5-7-8-6-4-2;;;;/h1,3-8H2,2H3;3*1H;/q;;;;+3/p-3
InChI key:InChIKey=INTLMJZQCBRQAT-UHFFFAOYSA-K
SMILES:C(CCCCCCC)[Sn](Cl)(Cl)Cl
Synonyms:- Mono-n-octyltin trichloride
- Monooctyltin trichloride
- NSC 297508
- Octyltin trichloride
- Octyltrichlorostannane
- Octyltrichlorotin
- Stannane, trichlorooctyl-
- Tin, trichlorooctyl-
- Trichloro(Octyl)Stannane
- Trichloro-n-octylstannane
- Trichlorooctylstannane
- n-Octyltin trichloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
n-Octyltin-trichloride
CAS:Controlled ProductFormula:C8H17Cl3SnColor and Shape:NeatMolecular weight:338.29n-Octyltin-trichloride 1000 µg/mL in Dichloromethane
CAS:Controlled ProductFormula:C8H17Cl3SnColor and Shape:Single SolutionMolecular weight:338.29Trichlorooctyl-stannane
CAS:<p>Stability Moisture Sensitive<br>Applications Trichlorooctyl-stannane is used as an end capping agent for high 1,4-vinyl content rubber having good wear resistance, mech. properties and reduced cold flow.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Sone, T., et al.: Eur. Pat. Appl., EP 863165 A1 19980909 (1998)<br></p>Formula:C8H17Cl3SnColor and Shape:BrownMolecular weight:338.29Trichlorooctyl-stannane-d17 (>85%)
CAS:Controlled ProductFormula:C8D17Cl3SnPurity:>85%Color and Shape:NeatMolecular weight:355.39


