CymitQuimica logo

CAS 309252-38-8

:

7-(3-bromopropoxy)-3-(4-hydroxyphenyl)-4H-chromen-4-one

Description:
7-(3-Bromopropoxy)-3-(4-hydroxyphenyl)-4H-chromen-4-one, with the CAS number 309252-38-8, is a synthetic organic compound belonging to the class of flavonoids, specifically a chromone derivative. This compound features a chromone backbone, which is characterized by a benzopyran structure, and is substituted with a bromopropoxy group and a hydroxyphenyl group. The presence of the bromine atom introduces notable electrophilic properties, while the hydroxy group contributes to its potential biological activity, including antioxidant and anti-inflammatory effects. The compound's solubility and stability can be influenced by the bromopropoxy substituent, which may also affect its interaction with biological targets. Due to its structural features, this compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. However, detailed studies on its specific biological effects and mechanisms of action would be necessary to fully understand its potential applications.
Formula:C18H15BrO4
InChI:InChI=1/C18H15BrO4/c19-8-1-9-22-14-6-7-15-17(10-14)23-11-16(18(15)21)12-2-4-13(20)5-3-12/h2-7,10-11,20H,1,8-9H2
SMILES:C(CBr)COc1ccc2c(c1)occ(c1ccc(cc1)O)c2=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.