CymitQuimica logo

CAS 309260-52-4

:

2-Hydroxy-1-(hydroxymethyl)ethyl (5Z,9α,13E,15S)-9,15-dihydroxy-11-oxoprosta-5,13-dien-1-oate

Description:
2-Hydroxy-1-(hydroxymethyl)ethyl (5Z,9α,13E,15S)-9,15-dihydroxy-11-oxoprosta-5,13-dien-1-oate, with CAS number 309260-52-4, is a chemical compound that belongs to the class of prostaglandin derivatives. This substance is characterized by its complex molecular structure, which includes multiple hydroxyl groups and a keto group, contributing to its reactivity and biological activity. It typically exhibits properties such as being a polar molecule due to the presence of hydroxyl groups, which can influence its solubility in water and organic solvents. The compound is likely to participate in various biochemical pathways, potentially acting as a signaling molecule in physiological processes. Its stereochemistry, indicated by the specific configuration at various chiral centers, is crucial for its biological function. Overall, this compound may have applications in pharmacology and biochemistry, particularly in studies related to inflammation, vascular biology, and reproductive health, although specific biological activities would require further investigation.
Formula:C23H38O7
InChI:InChI=1S/C23H38O7/c1-2-3-6-9-17(26)12-13-20-19(21(27)14-22(20)28)10-7-4-5-8-11-23(29)30-18(15-24)16-25/h4,7,12-13,17-21,24-27H,2-3,5-6,8-11,14-16H2,1H3/b7-4-,13-12+/t17-,19+,20+,21-/m0/s1
InChI key:InChIKey=OCYWGBZEVKVWBQ-PQGWWSFGSA-N
SMILES:C(/C=C\CCCC(OC(CO)CO)=O)[C@@H]1[C@@H](/C=C/[C@H](CCCCC)O)C(=O)C[C@@H]1O
Synonyms:
  • PGD2 2-glyceryl ester
  • Prosta-5,13-dien-1-oic acid, 9,15-dihydroxy-11-oxo-, 2-hydroxy-1-(hydroxymethyl)ethyl ester, (5Z,9α,13E,15S)-
  • 2-Hydroxy-1-(hydroxymethyl)ethyl (5Z,9α,13E,15S)-9,15-dihydroxy-11-oxoprosta-5,13-dien-1-oate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.