CAS 309263-13-6
:[(3S,5S,6S)-5-acetamido-3,6-diacetoxy-4-[(2S,3S,4S,5R)-3,4,5-triacetoxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,5S,6S)-5-acetamido-3,6-diacetoxy-4-[(2S,3S,4S,5R)-3,4,5-triacetoxy-6-methyl-tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 309263-13-6 is a complex organic compound characterized by multiple functional groups and stereocenters. It features a tetrahydropyran backbone, which is a six-membered cyclic ether, and includes acetyl and acetamido groups that contribute to its reactivity and solubility. The presence of multiple acetoxy groups suggests that the compound may exhibit significant polarity, influencing its solubility in various solvents. The stereochemistry indicated by the (S) and (R) designations implies that the compound may have specific spatial configurations that could affect its biological activity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and may serve as intermediates or active pharmaceutical ingredients. The detailed structure suggests potential applications in drug development, particularly in areas requiring specific stereochemical properties.
Formula:C26H37NO16
InChI:InChI=1/C26H37NO16/c1-10-20(37-13(4)30)23(39-15(6)32)24(40-16(7)33)26(36-10)43-22-19(27-11(2)28)25(41-17(8)34)42-18(9-35-12(3)29)21(22)38-14(5)31/h10,18-26H,9H2,1-8H3,(H,27,28)/t10?,18?,19-,20+,21+,22?,23-,24-,25+,26-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-Glucopyranose, 2-(acetylamino)-2-deoxy-3-O-(2,3,4-tri-O-acetyl-6-deoxy-α-L-galactopyranosyl)-, 1,4,6-triacetate
CAS:Formula:C26H37NO16Color and Shape:SolidMolecular weight:619.56912-Acetamido-2-deoxy-1,4,6-tri-O-acetyl-3-O-(2,3,4-tri-O-acetyl-a-L-fucopyranosyl)-D-glucopyranose
CAS:The chemical name of this product is 2-Acetamido-2-deoxy-1,4,6-tri-O-acetyl-3-O-(2,3,4-tri-O-acetyl-a-L-fucopyranosyl)-D--glucopyranose. This product is a synthetic carbohydrate that has been custom synthesized and modified. It is a complex carbohydrate with an acetamido group on the nonreducing end and an acetylated sugar moiety on the reducing end. This product can be used in methylation or glycosylation processes. The CAS number for this product is 309263-13--6 and it has a molecular weight of 569.Formula:C26H37NO16Purity:Min. 95%Molecular weight:619.57 g/mol


