CymitQuimica logo

CAS 3093-97-8

:

6-Fluoroindole-2-carboxylic acid

Description:
6-Fluoroindole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 6-position and a carboxylic acid group at the 2-position contributes to its unique properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while the indole moiety can participate in various chemical reactions, including electrophilic substitutions and hydrogen bonding. The fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. 6-Fluoroindole-2-carboxylic acid is of interest in medicinal chemistry and drug development, particularly for its potential applications in the synthesis of pharmaceuticals and agrochemicals. Its structural features may also allow for interactions with biological targets, making it a subject of study in various fields, including biochemistry and pharmacology.
Formula:C9H6FNO2
InChI:InChI=1/C9H6FNO2/c10-6-2-1-5-3-8(9(12)13)11-7(5)4-6/h1-4,11H,(H,12,13)
InChI key:LRTIKMXIKAOCDM-UHFFFAOYSA-N
SMILES:c1cc(cc2c1cc(C(=O)O)[nH]2)F
Synonyms:
  • 6-Fluoro-1H-indole-2-carboxylic acid
Found 6 products.