CAS 30933-67-6
:4,5-Dimethoxy-1H-indole
Description:
4,5-Dimethoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features two methoxy (-OCH3) groups located at the 4 and 5 positions of the indole ring, contributing to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. The presence of methoxy groups enhances its electron-donating ability, which can influence its reactivity and interactions with other chemical species. 4,5-Dimethoxy-1H-indole is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other compounds. As with many indole derivatives, it may exhibit properties such as fluorescence and can participate in various chemical reactions, including electrophilic substitutions and coupling reactions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-12-9-4-3-8-7(5-6-11-8)10(9)13-2/h3-6,11H,1-2H3
InChI key:InChIKey=XLORFNDUOILHCM-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=C1OC)NC=C2
Synonyms:- 4,5-Dimethoxy-1H-indole
- 4,5-Dimethoxyindole
- Indole, 4,5-dimethoxy-
- Indole,4,5-dimethoxy- (7CI,8CI)
- 1H-Indole, 4,5-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,5-Dimethoxyindole
CAS:4,5-Dimethoxyindole is a chemical compound that has been shown to exhibit radical scavenging activity. It is an inhibitor of integrase, which are enzymes involved in the integration of viral DNA into host cell chromosomes. This compound has been synthesized and its optical properties have been studied. The synthesis of 4,5-dimethoxyindole derivatives has also been investigated using molecular modeling. Schrodinger software was used to predict the geometry of these synthesized derivatives. These studies suggest that 4,5-dimethoxyindole may be a potential anti-cancer agent due to its ability to inhibit cancer cell growth and induce apoptosis.
Formula:C10H11NO2Purity:Min. 95%Color and Shape:SolidMolecular weight:177.2 g/mol


