CAS 30940-23-9
:Poly(o-fluorostyrene)
Description:
Poly(o-fluorostyrene) is a synthetic polymer characterized by its repeating units derived from o-fluorostyrene monomers. This polymer exhibits unique properties due to the presence of fluorine atoms, which enhance its chemical resistance, thermal stability, and hydrophobicity. The incorporation of fluorine can also influence the polymer's mechanical properties, making it suitable for various applications in coatings, adhesives, and electronic materials. Poly(o-fluorostyrene) typically has a high glass transition temperature, indicating its stability at elevated temperatures. Additionally, its optical properties can be modified, making it useful in applications requiring specific light transmission characteristics. The polymer's solubility is generally limited to certain organic solvents, reflecting its hydrophobic nature. Overall, poly(o-fluorostyrene) is valued in advanced material science for its distinctive characteristics that arise from the fluorinated structure, enabling its use in specialized industrial applications.
Formula:(C8H7F)x
InChI:InChI=1S/C8H7F/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2
InChI key:InChIKey=YNQXOOPPJWSXMW-UHFFFAOYSA-N
SMILES:C(=C)C1=C(F)C=CC=C1
Synonyms:- o-Fluorostyrene polymer
- o-Fluorostyrene homopolymer
- Styrene, o-fluoro-, polymers
- Benzene, 1-ethenyl-2-fluoro-, homopolymer
- Poly(o-fluorostyrene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
