CAS 30963-12-3

1-methyl-1-(3-nitro-2-pyridyl)hydrazine

Description:

1-Methyl-1-(3-nitro-2-pyridyl)hydrazine, with the CAS number 30963-12-3, is an organic compound characterized by its hydrazine functional group, which is linked to a methyl group and a nitro-substituted pyridine ring. This compound typically appears as a yellow to orange solid and is known for its potential use in various chemical applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The presence of the nitro group contributes to its reactivity and may influence its biological activity. Additionally, the pyridine ring can impart specific electronic properties, making it useful in coordination chemistry. Safety considerations are important when handling this compound, as it may pose health risks due to its hydrazine structure, which is known to be toxic and potentially carcinogenic. Proper storage and handling protocols should be followed to mitigate any hazards associated with exposure. Overall, 1-methyl-1-(3-nitro-2-pyridyl)hydrazine is a compound of interest in both research and industrial contexts.

Formula: C₆H₈N₄O₂

InChI: InChI=1/C6H8N4O2/c1-9(7)6-5(10(11)12)3-2-4-8-6/h2-4H,7H2,1H3

SMILES: CN(c1c(cccn1)N(=O)=O)N

Synonyms:

• 2-(1-Methylhydrazino)-3-Nitropyridine

1-Methyl-1-(3-nitro-2-pyridyl)hydrazine

CAS: 30963-12-3

Formula: C₆H₈N₄O₂

Molecular weight: 168.1533

Ref: IN-DA0031RQ

2-(1-Methylhydrazino)-3-nitropyridine

CAS: 30963-12-3

2-(1-Methylhydrazino)-3-nitropyridine

Formula: C₆H₈N₄O₂

Purity: ≥95%

Color and Shape: dark yellow. crystalline solid

Molecular weight: 168.15g/mol

Ref: 54-OR23731