
CAS 3098-65-5
:Benzeneacetic acid, α-phenyl-, 3-(diethylamino)propyl ester, hydrochloride
Description:
Benzeneacetic acid, α-phenyl-, 3-(diethylamino)propyl ester, hydrochloride, commonly referred to as a diethylamino derivative of benzeneacetic acid, is a chemical compound characterized by its ester functional group and the presence of a diethylamino moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility compared to the free base. It exhibits properties associated with both the benzeneacetic acid and diethylamino groups, potentially influencing its biological activity and pharmacological profile. The presence of the diethylamino group may impart basic characteristics, allowing for interactions with various biological targets. This compound is often studied in the context of medicinal chemistry and pharmacology, where it may exhibit effects related to neurotransmitter modulation or other therapeutic applications. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C21H27NO2·ClH
InChI:InChI=1S/C21H27NO2.ClH/c1-3-22(4-2)16-11-17-24-21(23)20(18-12-7-5-8-13-18)19-14-9-6-10-15-19;/h5-10,12-15,20H,3-4,11,16-17H2,1-2H3;1H
InChI key:InChIKey=KLGBXKGAWZWAIX-UHFFFAOYSA-N
SMILES:C(C(OCCCN(CC)CC)=O)(C1=CC=CC=C1)C2=CC=CC=C2.Cl
Synonyms:- Arpenal
- Benzeneacetic acid, α-phenyl-, 3-(diethylamino)propyl ester, hydrochloride
- Acetic acid, diphenyl-, 3-(diethylamino)propyl ester hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzeneacetic acid, α-phenyl-, 3-(diethylamino)propyl ester, hydrochloride (9CI)
CAS:Formula:C21H28ClNO2Molecular weight:361.9055Arpenal HCl
CAS:Arpenal HCl is a ganglionic blocking agent which may be useful in the treatment of bronchial asthma.Formula:C21H28ClNO2Color and Shape:SolidMolecular weight:361.91

