CAS 3098-92-8
:Cinnamicacid vinylester
Description:
Cinnamic acid vinyl ester, also known as vinyl cinnamate, is an organic compound characterized by its vinyl group attached to the cinnamic acid structure. It typically appears as a colorless to pale yellow liquid with a sweet, floral aroma, making it of interest in the fragrance and flavor industries. The compound is known for its reactivity, particularly in polymerization processes, where it can undergo various chemical reactions due to the presence of both the vinyl and aromatic functionalities. Cinnamic acid vinyl ester is soluble in organic solvents but has limited solubility in water. It is often used as a building block in organic synthesis and can serve as a precursor for various derivatives. Additionally, it exhibits some degree of biological activity, which has led to studies exploring its potential applications in pharmaceuticals and as a natural product. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C11H10O2
InChI:InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+
Synonyms:- Cinnamic acid vinyl ester
- Vinyl cinnamate, (Cinnamic acid vinyl ester)
- Vinyl cinnamate
- Ethenyl 3-Phenylprop-2-Enoate
- ethenyl (2E)-3-phenylprop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Vinyl Cinnamate (stabilized with MEHQ)
CAS:Formula:C11H10O2Purity:>99.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:174.20Vinyl Cinnamate
CAS:Vinyl Cinnamate is a nartural product from Cinnamomum cassia Presl.Formula:C11H10O2Purity:98.81%Color and Shape:SolidMolecular weight:174.2



