CymitQuimica logo

CAS 30992-81-5

:

4-hydroxy-3-[1-(3-hydroxyphenyl)-3-oxo-butyl]chromen-2-one

Description:
4-Hydroxy-3-[1-(3-hydroxyphenyl)-3-oxo-butyl]chromen-2-one, with the CAS number 30992-81-5, is a synthetic organic compound belonging to the class of flavonoids. This compound features a chromone backbone, characterized by a benzopyran structure, which is substituted at various positions. The presence of a hydroxy group at the 4-position and a phenyl group at the 3-position contributes to its potential biological activity, including antioxidant and anti-inflammatory properties. The compound's structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important for its application in research and potential therapeutic uses. Additionally, the compound may exhibit fluorescence, making it useful in analytical applications. Overall, 4-hydroxy-3-[1-(3-hydroxyphenyl)-3-oxo-butyl]chromen-2-one represents a fascinating subject for further investigation in the fields of biochemistry and drug development.
Formula:C19H16O5
InChI:InChI=1/C19H16O5/c1-11(20)9-15(12-5-4-6-13(21)10-12)17-18(22)14-7-2-3-8-16(14)24-19(17)23/h2-8,10,15,21-22H,9H2,1H3
SMILES:CC(=O)CC(c1cccc(c1)O)c1c(c2ccccc2oc1=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.