CAS 309942-87-8

Benzoic acid, 3-nitro-4-[[(tetrahydro-2-furanyl)methyl]amino]-

Description:

Benzoic acid, 3-nitro-4-[[(tetrahydro-2-furanyl)methyl]amino]- is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a nitro group and an amino group linked to a tetrahydro-2-furanyl group. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and stability. The tetrahydro-2-furanyl group adds a cyclic ether component, which can affect solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 309942-87-8, allows for precise identification in chemical databases. Overall, the unique combination of functional groups in this compound suggests potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₂H₁₄N₂O₅

InChI: InChI=1S/C12H14N2O5/c15-12(16)8-3-4-10(11(6-8)14(17)18)13-7-9-2-1-5-19-9/h3-4,6,9,13H,1-2,5,7H2,(H,15,16)

InChI key: XZOJOADZBOXPHS-UHFFFAOYSA-N

SMILES: C1CC(OC1)CNC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-]