CAS 309964-23-6
:4-(4-formyl-3-methoxyphenoxy)butanoic acid
Description:
4-(4-formyl-3-methoxyphenoxy)butanoic acid, with the CAS number 309964-23-6, is an organic compound characterized by its functional groups and structural features. It contains a butanoic acid moiety, which contributes to its carboxylic acid properties, allowing it to participate in acid-base reactions. The presence of the formyl group indicates that it can undergo further reactions typical of aldehydes, such as condensation or oxidation. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic (butanoic acid and phenyl) and hydrophilic (carboxylic acid) characteristics. Its structural complexity suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of aromatic rings may impart stability and influence the compound's electronic properties, making it of interest in materials science and medicinal chemistry.
Formula:C12H14O5
InChI:InChI=1/C12H14O5/c1-16-11-7-10(5-4-9(11)8-13)17-6-2-3-12(14)15/h4-5,7-8H,2-3,6H2,1H3,(H,14,15)
SMILES:COc1cc(ccc1C=O)OCCCC(=O)O
Synonyms:- Butanoic acid, 4-(4-formyl-3-methoxyphenoxy)-
- 4-(4-Formyl-3-Methoxyphenoxy)Butanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(4′-Formyl-3′-methoxy)phenoxy butyric acid
CAS:Formula:C12H14O5Purity:96%Color and Shape:SolidMolecular weight:238.2394-(4-Formyl-3-methoxy-phenoxy)-butyric acid
CAS:Formula:C12H14O5Purity:98%Color and Shape:SolidMolecular weight:238.23664-(4-Formyl-3-Methoxyphenoxy)Butanoic Acid
CAS:4-(4-Formyl-3-Methoxyphenoxy)Butanoic AcidPurity:98%Molecular weight:238.24g/mol4-(4-Formyl-3-methoxyphenoxy)butanoic acid
CAS:Controlled Product4-(4'-Formyl-3'-methoxyphenoxy)butanoic acid is a carboxylate that can be used as a preloaded reagent for the synthesis of peptides, proteins, and other organic molecules. 4-(4'-Formyl-3'-methoxyphenoxy)butanoic acid has been shown to be an efficient linker for solid-phase peptide synthesis. 4-(4'-Formyl-3'-methoxyphenoxy)butanoic acid is labile to hydrolysis and so should be stored in an organic solvent such as dimethylsulfoxide. The carboxylate group is readily available in the form of its sodium salt, which can be synthesized by reacting sodium acetate with formaldehyde.Formula:C12H14O5Purity:Min. 95%Color and Shape:PowderMolecular weight:238.24 g/mol



