CAS 309977-78-4
:5-Bromo-N,N-di-2-propen-1-yl-2-pyridinamine
Description:
5-Bromo-N,N-di-2-propen-1-yl-2-pyridinamine is an organic compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and two propenyl groups. This compound features a nitrogen atom in the amine functional group, contributing to its basicity and potential reactivity. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The propenyl groups provide sites for further functionalization, allowing for the synthesis of more complex molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and conditions, which is important for its application in laboratory settings. Overall, 5-Bromo-N,N-di-2-propen-1-yl-2-pyridinamine is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C11H13BrN2
InChI:InChI=1S/C11H13BrN2/c1-3-7-14(8-4-2)11-6-5-10(12)9-13-11/h3-6,9H,1-2,7-8H2
InChI key:InChIKey=FFOVPWZZBVPOKA-UHFFFAOYSA-N
SMILES:N(CC=C)(CC=C)C1=CC=C(Br)C=N1
Synonyms:- 2-Pyridinamine, 5-bromo-N,N-di-2-propenyl-
- 2-Pyridinamine, 5-bromo-N,N-di-2-propen-1-yl-
- 5-Bromo-N,N-di-2-propen-1-yl-2-pyridinamine
- 3-Bromo-6-diallylaminopyridine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery