CymitQuimica logo

CAS 31002-12-7

:

7-O-Methylmangiferin

Description:
7-O-Methylmangiferin is a naturally occurring flavonoid glycoside, primarily derived from the mango tree (Mangifera indica) and other plants. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anti-diabetic properties. The compound features a complex structure that includes a xanthone core, which is characteristic of mangiferin, with a methoxy group at the 7-position. This modification can influence its solubility and biological activity. 7-O-Methylmangiferin is often studied for its pharmacological effects and potential therapeutic applications, particularly in traditional medicine. Its CAS number, 31002-12-7, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. As with many natural products, the extraction and purification processes can affect its stability and bioactivity, making it a subject of interest in both pharmacognosy and medicinal chemistry. Overall, 7-O-Methylmangiferin represents a significant area of research due to its promising health-related properties.
Formula:C20H20O11
InChI:InChI=1S/C20H20O11/c1-29-10-2-6-9(3-7(10)22)30-11-4-8(23)13(17(26)14(11)15(6)24)20-19(28)18(27)16(25)12(5-21)31-20/h2-4,12,16,18-23,25-28H,5H2,1H3/t12-,16-,18+,19-,20+/m1/s1
InChI key:INBSFHNHCNZEOY-PQSJUMPYSA-N
SMILES:COC1=C(C=C2C(=C1)C(=O)C3=C(O2)C=C(C(=C3O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O
Synonyms:
  • O-Methylmangiferin, 7-
Found 7 products.