CAS 31007-28-0

Piperidine,1-(3,3-dimethoxypropyl)-

Description:

Piperidine, 1-(3,3-dimethoxypropyl)-, is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a propyl side chain that is further substituted with two methoxy groups at the 3-position, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive amine-like odor. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Piperidine derivatives are often studied for their potential applications in pharmaceuticals, particularly as intermediates in the synthesis of various bioactive compounds. The compound's molecular structure suggests it may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to participate in protonation reactions. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₀H₂₁NO₂

InChI: InChI=1S/C10H21NO2/c1-12-10(13-2)6-9-11-7-4-3-5-8-11/h10H,3-9H2,1-2H3

InChI key: ALCCJPFPDHQXAE-UHFFFAOYSA-N

SMILES: COC(CCN1CCCCC1)OC

Synonyms:

• 1-Piperidinepropionaldehyde,dimethyl acetal (6CI,8CI)