CAS 31008-18-1
:(1S,3aR,4S,6aR)-1-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan
Description:
The chemical substance known as "(1S,3aR,4S,6aR)-1-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan," with the CAS number 31008-18-1, is a complex organic compound characterized by its unique tetrahydrofuran and furofuran structures. This compound features multiple methoxy groups, which contribute to its potential biological activity and solubility properties. The stereochemistry indicated by the (1S,3aR,4S,6aR) configuration suggests specific spatial arrangements of its atoms, which can significantly influence its reactivity and interactions with biological targets. Such compounds are often studied for their pharmacological properties, including potential antioxidant, anti-inflammatory, or anticancer activities. The presence of aromatic rings with methoxy substituents enhances the compound's electronic properties, potentially affecting its interaction with enzymes or receptors. Overall, this substance exemplifies the complexity and diversity of organic compounds in medicinal chemistry, warranting further investigation into its potential applications in drug development and therapeutic uses.
Formula:C23H28O7
InChI:InChI=1/C23H28O7/c1-24-17-7-6-13(8-18(17)25-2)21-15-11-30-22(16(15)12-29-21)14-9-19(26-3)23(28-5)20(10-14)27-4/h6-10,15-16,21-22H,11-12H2,1-5H3/t15-,16-,21+,22+/m0/s1
Synonyms:- 1H,3H-furo[3,4-c]furan, 1-(3,4-dimethoxyphenyl)tetrahydro-4-(3,4,5-trimethoxyphenyl)-, (1S,3aR,4S,6aR)-
- Magnolin
- (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
1H,3H-Furo[3,4-c]furan, 1-(3,4-dimethoxyphenyl)tetrahydro-4-(3,4,5-trimethoxyphenyl)-, (1S,3aR,4S,6aR)-
CAS:Formula:C23H28O7Purity:98%Color and Shape:SolidMolecular weight:416.4642Magnolin
CAS:<p>Magnolin</p>Formula:C23H28O7Purity:98.0% (Typical Value in Batch COA)Color and Shape: white solidMolecular weight:416.46g/molmagnolin
CAS:<p>Magnolin reduces the renal oxidative stress, suppresses caspase-3 activity, and increases Bcl-2 expression in vivo and in vitro.</p>Formula:C23H28O7Purity:98% - 99.77%Color and Shape:SolidMolecular weight:416.46Magnolin
CAS:Oxygen-heterocyclic compoundFormula:C23H28O7Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:416.47Magnolin
CAS:<p>Magnolin is a bioactive compound, which is a lignan isolated from the plant Magnolia officinalis. It functions as a natural product with various modes of action, primarily interacting with multiple signaling pathways in biological systems. Magnolin primarily inhibits the phosphorylation of key proteins involved in processes such as inflammation and cancer cell proliferation.</p>Formula:C23H28O7Purity:Min. 95%Color and Shape:PowderMolecular weight:416.46 g/mol










