CAS 31008-18-1: (1S,3aR,4S,6aR)-1-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan
Description:The chemical substance known as "(1S,3aR,4S,6aR)-1-(3,4-dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan," with the CAS number 31008-18-1, is a complex organic compound characterized by its unique tetrahydrofuran and furofuran structures. This compound features multiple methoxy groups, which contribute to its potential biological activity and solubility properties. The stereochemistry indicated by the (1S,3aR,4S,6aR) configuration suggests specific spatial arrangements of its atoms, which can significantly influence its reactivity and interactions with biological targets. Such compounds are often studied for their pharmacological properties, including potential antioxidant, anti-inflammatory, or anticancer activities. The presence of aromatic rings with methoxy substituents enhances the compound's electronic properties, potentially affecting its interaction with enzymes or receptors. Overall, this substance exemplifies the complexity and diversity of organic compounds in medicinal chemistry, warranting further investigation into its potential applications in drug development and therapeutic uses.
Formula:C23H28O7
InChI:InChI=1/C23H28O7/c1-24-17-7-6-13(8-18(17)25-2)21-15-11-30-22(16(15)12-29-21)14-9-19(26-3)23(28-5)20(10-14)27-4/h6-10,15-16,21-22H,11-12H2,1-5H3/t15-,16-,21+,22+/m0/s1
- Synonyms:
- 1H,3H-furo[3,4-c]furan, 1-(3,4-dimethoxyphenyl)tetrahydro-4-(3,4,5-trimethoxyphenyl)-, (1S,3aR,4S,6aR)-
- Magnolin
- (1S,3aR,4S,6aR)-1-(3,4-Dimethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan