CAS 31011-01-5

Acetamide, N-[4-[(2-methyl-2-propenyl)oxy]phenyl]-

Description:

Acetamide, N-[4-[(2-methyl-2-propenyl)oxy]phenyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This substance features a phenyl ring substituted with a propenyl ether group, contributing to its unique chemical properties. The presence of the propenyl group suggests potential reactivity, particularly in polymerization or addition reactions. Acetamides generally exhibit moderate solubility in polar solvents due to their ability to form hydrogen bonds, while the aromatic and aliphatic components can influence hydrophobic interactions. This compound may be utilized in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and stability would depend on the surrounding conditions, such as temperature and pH. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, the structural features of Acetamide, N-[4-[(2-methyl-2-propenyl)oxy]phenyl]- suggest it may have interesting applications in chemical synthesis and material science.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1S/C12H15NO2/c1-9(2)8-15-12-6-4-11(5-7-12)13-10(3)14/h4-7H,1,8H2,2-3H3,(H,13,14)

InChI key: KZLWWMYAFYETPA-UHFFFAOYSA-N

SMILES: CC(=C)COC1=CC=C(C=C1)NC(=O)C