CAS 31024-49-4
:N-[3-[methoxy(dimethyl)silyl]-2-methyl-propyl]ethane-1,2-diamine
Description:
N-[3-[methoxy(dimethyl)silyl]-2-methyl-propyl]ethane-1,2-diamine, with the CAS number 31024-49-4, is an organosilicon compound characterized by the presence of a silane group, which contributes to its unique properties. This compound features a methoxy group attached to a dimethylsilyl moiety, enhancing its reactivity and solubility in various organic solvents. The presence of the ethane-1,2-diamine structure indicates that it has two amine functional groups, which can participate in hydrogen bonding and coordination with metal ions, making it useful in various applications, including as a coupling agent or in surface modification. Its branched alkyl chain contributes to its hydrophobic characteristics, while the methoxy group can provide some degree of polarity. Overall, this compound is likely to exhibit properties typical of silane compounds, such as adhesion promotion, and may be utilized in fields like materials science, coatings, and polymer chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H24N2OSi
InChI:InChI=1/C9H24N2OSi/c1-9(7-11-6-5-10)8-13(3,4)12-2/h9,11H,5-8,10H2,1-4H3
InChI key:XKHOHWZKCFNGEP-UHFFFAOYSA-N
SMILES:CC(CNCCN)C[Si](C)(C)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery