CAS 31034-03-4
:6,6'-oxydinaphthalene-2-sulfonic acid
Description:
6,6'-Oxydinaphthalene-2-sulfonic acid is an organic compound characterized by its structure, which features two naphthalene rings connected by an ether linkage and a sulfonic acid group. This compound is typically a white to light yellow solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. It is often used as a fluorescent dye or a pH indicator in various applications, including biological and chemical research. The sulfonic acid group imparts acidic properties, making it useful in various chemical reactions and as a reagent in analytical chemistry. Additionally, its unique structure allows for potential applications in materials science, particularly in the development of organic semiconductors and sensors. Safety data indicates that, like many sulfonic acids, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 6,6'-oxydinaphthalene-2-sulfonic acid is a versatile compound with significant utility in both academic and industrial settings.
Formula:C20H14O7S2
InChI:InChI=1/C20H14O7S2/c21-28(22,23)19-7-3-13-9-17(5-1-15(13)11-19)27-18-6-2-16-12-20(29(24,25)26)8-4-14(16)10-18/h1-12H,(H,21,22,23)(H,24,25,26)
SMILES:c1cc(cc2ccc(cc12)S(=O)(=O)O)Oc1ccc2cc(ccc2c1)S(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
