CAS 310451-84-4
:5-(2-Thienyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
Description:
5-(2-Thienyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core fused with a thiophene ring and a trifluoromethyl group. This compound typically exhibits a range of chemical properties due to the presence of multiple functional groups, including a carboxylic acid, which can participate in hydrogen bonding and influence its solubility and reactivity. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, making the compound potentially useful in medicinal chemistry. Additionally, the thienyl moiety can contribute to the compound's electronic properties, possibly affecting its interaction with biological targets. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its unique structural features and functional groups suggest potential applications in various fields, including drug discovery and materials science.
Formula:C12H6F3N3O2S
InChI:InChI=1S/C12H6F3N3O2S/c13-12(14,15)9-4-7(8-2-1-3-21-8)17-10-6(11(19)20)5-16-18(9)10/h1-5H,(H,19,20)
InChI key:InChIKey=BQRJQAACCPRZPK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2N(C(C(F)(F)F)=CC(=N2)C3=CC=CS3)N=C1
Synonyms:- 5-(2-Thienyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
- Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 5-(2-thienyl)-7-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.