CAS 310455-02-8
:(3S)-N,N-dimethylpiperidine-3-carboxamide
Description:
(3S)-N,N-dimethylpiperidine-3-carboxamide is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) directly bonded to a nitrogen atom (N). The dimethyl substitution on the nitrogen atom contributes to its steric properties and can influence its reactivity and interaction with biological targets. This compound is typically used in medicinal chemistry and may serve as a building block in the synthesis of various pharmaceuticals. Its stereochemistry, denoted by the (3S) configuration, suggests that it has specific spatial arrangements that can affect its biological activity and pharmacokinetics. The presence of both the piperidine and carboxamide functionalities allows for potential hydrogen bonding interactions, which can be crucial for binding to biological receptors. Overall, (3S)-N,N-dimethylpiperidine-3-carboxamide is a versatile compound with applications in drug development and research.
Formula:C8H16N2O
InChI:InChI=1/C8H16N2O/c1-10(2)8(11)7-4-3-5-9-6-7/h7,9H,3-6H2,1-2H3/t7-/m0/s1
Synonyms:- 3-piperidinecarboxamide, N,N-dimethyl-, (3S)-
- (3S)-N,N-Dimethylpiperidine-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
