CAS 31075-58-8

2-(morpholin-4-yl)-1H-benzimidazole

Description:

2-(Morpholin-4-yl)-1H-benzimidazole, with the CAS number 31075-58-8, is a chemical compound characterized by its unique structure that combines a benzimidazole core with a morpholine substituent. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the morpholine ring may contribute to its ability to interact with biological targets, potentially influencing its pharmacological profile. The benzimidazole moiety is known for its role in various biological activities, including antimicrobial and anticancer properties. Additionally, the compound may exhibit stability under standard laboratory conditions, although specific reactivity can depend on the functional groups present. Its synthesis often involves multi-step organic reactions, and it may serve as a scaffold for the development of novel therapeutic agents. Overall, 2-(morpholin-4-yl)-1H-benzimidazole represents a versatile structure in the field of drug discovery and development.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1/C11H13N3O/c1-2-4-10-9(3-1)12-11(13-10)14-5-7-15-8-6-14/h1-4H,5-8H2,(H,12,13)

SMILES: c1ccc2c(c1)nc([nH]2)N1CCOCC1

Synonyms:

• 1H-benzimidazole, 2-(4-morpholinyl)-

1H-Benzimidazole, 2-(4-morpholinyl)-

CAS: 31075-58-8

Formula: C₁₁H₁₃N₃O

Purity: %

Molecular weight: 203.2404

Ref: IN-DA00321S

4-(1h-Benzo[d]imidazol-2-yl)morpholine

CAS: 31075-58-8

4-(1h-Benzo[d]imidazol-2-yl)morpholine

Purity: 96%

Molecular weight: 203.24g/mol

Ref: 54-OR1001729

2-(4-Morpholinyl)-1H-benzimidazole

CAS: 31075-58-8

Purity: 95.0%

Color and Shape: Solid, White powder

Molecular weight: 203.2449951171875

Ref: 10-F311802