CAS 31082-90-3
:2,3-Dihydroxycinnamic acid
Description:
2,3-Dihydroxycinnamic acid, with the CAS number 31082-90-3, is an organic compound that belongs to the class of phenolic acids. It is characterized by the presence of two hydroxyl (-OH) groups located at the 2 and 3 positions of the cinnamic acid structure, which consists of a trans-styryl group attached to a carboxylic acid. This compound typically exhibits a white to pale yellow crystalline appearance and is soluble in polar solvents such as water and ethanol. 2,3-Dihydroxycinnamic acid is known for its antioxidant properties, which contribute to its potential applications in food preservation and cosmetics. Additionally, it may play a role in various biological activities, including anti-inflammatory and antimicrobial effects. The compound's structure allows it to participate in various chemical reactions, making it of interest in both synthetic and natural product chemistry. Its derivatives and analogs are often studied for their potential therapeutic benefits in medicinal chemistry.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-7-3-1-2-6(9(7)13)4-5-8(11)12/h1-5,10,13H,(H,11,12)
InChI key:InChIKey=SIUKXCMDYPYCLH-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(O)C(O)=CC=C1
Synonyms:- (2E)-3-(2,3-Dihydroxyphenyl)acrylic acid
- 2-Propenoic acid, 3-(2,3-dihydroxyphenyl)-
- 3-(2,3-Dihydroxyphenyl)-2-propenoic acid
- Anthenobilic acid
- Cinnamic acid, 2,3-dihydroxy-
- 2-propenoic acid, 3-(2,3-dihydroxyphenyl)-, (2E)-
- 2,3-Dihydroxycinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(2,3-Dihydroxyphenyl)prop-2-enoic acid
CAS:3-(2,3-Dihydroxyphenyl)prop-2-enoic acid is a metabolite of trans-cinnamic acid. It is a conjugate acid of 3-(2,3-dihydroxyphenyl)propionic acid and a conjugate base of 3-(2,3-dihydroxyphenyl)propanoic acid. 3-(2,3-Dihydroxyphenyl)prop-2-enoic acid is an inhibitor of escherichia coli and has been shown to be effective in the treatment of this bacterial infection. This metabolite binds to the enzyme escherichia coli adenylate kinase which regulates the synthesis of ATP and its activity can be inhibited by this binding. 3-(2,3-Dihydroxyphenyl)prop-2-enoic acid also inhibits bacterial DNA gyrase and topoisomerase IV enzymes that maintainFormula:C9H8O4Purity:Min. 95%Molecular weight:180.16 g/mol

