CAS 31083-55-3
:2-(3-Pyridinylmethylene)-1H-indene-1,3(2H)-dione
Description:
2-(3-Pyridinylmethylene)-1H-indene-1,3(2H)-dione, with the CAS number 31083-55-3, is a chemical compound characterized by its unique structure that combines an indene dione framework with a pyridine moiety. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antimicrobial and anticancer properties. It is soluble in organic solvents, which makes it suitable for various applications in organic synthesis and medicinal chemistry. The presence of the pyridine ring contributes to its reactivity and ability to form coordination complexes with metals. Additionally, the compound may undergo various chemical transformations, such as oxidation or reduction, depending on the reaction conditions. Its structural features allow for interactions with biological targets, making it a subject of interest in drug discovery and development. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C15H9NO2
InChI:InChI=1S/C15H9NO2/c17-14-11-5-1-2-6-12(11)15(18)13(14)8-10-4-3-7-16-9-10/h1-9H
InChI key:InChIKey=OMHZFEWYVFWVLI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C1=CC=3C=CC=NC3)=CC=CC2
Synonyms:- 1,3-Indandione, 2-(3-pyridylmethylene)-
- 1H-indene-1,3(2H)-dione, 2-(3-pyridinylmethylene)-
- 2-(3-Pyridinylmethylene)-1H-indene-1,3(2H)-dione
- 2-(3-Pyridylmethylene)-1,3-indandione
- 2-(Pyridin-3-ylmethylene)-1H-indene-1,3(2H)-dione
- 2-(Pyridin-3-ylmethylidene)indene-1,3-dione
- 2-Pyridin-3-ylmethylene-indan-1,3-dione
- 2-[(Pyridin-3-yl)methylidene]-2,3-dihydro-1H-indene-1,3-dione
- NSC 600157
- Prt 4165
- Sml 1013
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Indene-1,3(2H)-dione, 2-(3-pyridinylmethylene)-
CAS:Formula:C15H9NO2Purity:98%Color and Shape:SolidMolecular weight:235.2375PRT4165
CAS:PRT4165 (NSC600157) is a potent PRC1-mediated H2A ubiquitylation inhibitor.Formula:C15H9NO2Purity:98.91% - 99.6%Color and Shape:SolidMolecular weight:235.24Ref: TM-T3110
5mg43.00€10mg49.00€1mL*10mM (DMSO)50.00€25mg88.00€50mg112.00€100mg182.00€200mg254.00€500mg427.00€2-(3-PYRIDINYLMETHYLENE)-1H-INDENE-1,3(2H)-DIONE
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:235.24200439453125(2E)-2-(Pyridin-3-ylmethylidene)-2,3-dihydro-1H-indene-1,3-dione
CAS:(2E)-2-(Pyridin-3-ylmethylidene)-2,3-dihydro-1H-indene-1,3-dione is a fluorescent probe that emits light in response to contact with the enzyme caspase 3. It has been shown to be effective in monitoring the activity of caspase 3 in cells and tissues. This probe is used for the treatment of cancer by apoptosis induction and DNA fragmentation. It acts as an anti-cancer agent by binding to the protein transfer which inhibits the proteasome from degrading proteins that are involved in cell proliferation. This leads to accumulation of these proteins, which cause cells to die through apoptosis.
Formula:C15H9NO2Purity:Min. 95%Molecular weight:235.24 g/mol





