CAS 310886-79-4

methyl 5-fluoro-1H-indole-3-carboxylate

Description:

Methyl 5-fluoro-1H-indole-3-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 5-position of the indole ring enhances its reactivity and may influence its biological activity. The carboxylate functional group, esterified with a methyl group, contributes to its solubility and reactivity, making it a useful intermediate in organic synthesis. This compound is often utilized in medicinal chemistry and drug development due to its potential pharmacological properties. Its molecular structure allows for various substitution reactions, making it versatile for further chemical modifications. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. As with many fluorinated compounds, it may exhibit unique interactions with biological targets, making it of interest in research related to pharmaceuticals and agrochemicals. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₀H₈FNO₂

InChI: InChI=1/C10H8FNO2/c1-14-10(13)8-5-12-9-3-2-6(11)4-7(8)9/h2-5,12H,1H3

SMILES: COC(=O)c1c[nH]c2ccc(cc12)F

Synonyms:

• 1H-indole-3-carboxylic acid, 5-fluoro-, methyl ester
• 5-Fluoro-1H-indole-3-carboxylic acid methyl ester

5-Fluoro-1H-indole-3-carboxylic acid methyl ester

CAS: 310886-79-4

Formula: C₁₀H₈FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 193.1744

Ref: IN-DA00322Z

Methyl 5-fluoro-1H-indole-3-carboxylate

CAS: 310886-79-4

Methyl 5-fluoro-1H-indole-3-carboxylate

Purity: 98%

Molecular weight: 193.17g/mol

Ref: 54-PC402018

Methyl 5-fluoro-1H-indole-3-carboxylate

CAS: 310886-79-4

Formula: C₁₀H₈FNO₂

Purity: 98%

Color and Shape: Brownish yellow powder

Molecular weight: 193.177

Ref: 10-F221686