CAS 31089-39-1
:Copper triethanolamine
Description:
Copper triethanolamine, with the CAS number 31089-39-1, is a coordination compound formed by the complexation of copper ions with triethanolamine, a polyamine. This substance typically appears as a blue or greenish solution, indicative of the presence of copper, which is known for its characteristic color in various oxidation states. It is soluble in water and exhibits chelating properties due to the multiple hydroxyl and amine groups present in triethanolamine, allowing it to effectively bind metal ions. Copper triethanolamine is often utilized in agricultural applications as a fungicide and in various industrial processes, including metal plating and as a catalyst in chemical reactions. Its effectiveness in these roles is attributed to its ability to enhance the bioavailability of copper, promoting its uptake in plants while also exhibiting antimicrobial properties. Safety considerations include handling precautions due to potential toxicity associated with copper compounds, necessitating appropriate protective measures during use.
Formula:C6H15NO3·xCu
InChI:InChI=1S/C6H15NO3.Cu/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;
InChI key:InChIKey=HSXKMKJYFOZAIV-UHFFFAOYSA-N
SMILES:N(CCO)(CCO)CCO.[Cu]
Synonyms:- Ethanol, 2,2′,2′′-nitrilotris-, copper salt (1:?)
- Triethanolamine-copper complex
- Copper triethanolamine
- Ethanol, 2,2′,2′′-nitrilotris-, copper salt
- Ethanol, 2,2′,2′′-nitrilotri-, copper salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
