CAS 31103-86-3
:Ketodeoxynonulonsonic Acid
Description:
Ketodeoxynonulonsonic acid, identified by its CAS number 31103-86-3, is a chemical compound that belongs to the class of nonulosonic acids, which are a type of sialic acid. These compounds are characterized by their nine-carbon backbone and contain functional groups that contribute to their biological activity. Ketodeoxynonulonsonic acid is notable for its role in various biological processes, particularly in the context of cell recognition and signaling. It is often found in glycoproteins and glycolipids, playing a crucial role in cellular interactions and immune responses. The structure of ketodeoxynonulonsonic acid includes a ketone functional group, which is significant for its reactivity and interaction with other biomolecules. Additionally, this compound may exhibit unique properties such as solubility in water and potential for modification, which can influence its biological functions. Overall, ketodeoxynonulonsonic acid is an important molecule in biochemistry and molecular biology, with implications in health and disease.
Formula:C6H12O6
InChI:InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6?/m1/s1
Synonyms:- Mannose
- DL-Mannose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
