CAS 31105-03-0
:(2S)-3-phenyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}propanoic acid (non-preferred name)
Description:
The chemical substance known as (2S)-3-phenyl-2-{[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino}propanoic acid, with the CAS number 31105-03-0, is a complex organic compound characterized by its chiral centers and multiple functional groups. It features an amino acid backbone, which is typical for compounds involved in biological processes, particularly in the context of peptide synthesis or as potential pharmaceuticals. The presence of a phenyl group contributes to its hydrophobic characteristics, while the tetrahydroxyhexyl moiety indicates a high degree of polarity, suggesting potential solubility in aqueous environments. The stereochemistry of the molecule is significant, as the specific arrangement of atoms can influence its biological activity and interactions with other molecules. This compound may exhibit properties such as being a potential ligand or substrate in enzymatic reactions, and its structural complexity could lead to interesting pharmacological profiles. Overall, its unique combination of functional groups and stereochemistry makes it a subject of interest in medicinal chemistry and biochemistry.
Formula:C15H21NO7
InChI:InChI=1/C15H21NO7/c17-8-12(19)14(21)13(20)11(18)7-16-10(15(22)23)6-9-4-2-1-3-5-9/h1-5,10,12-14,16-17,19-21H,6-8H2,(H,22,23)/t10-,12+,13+,14+/m0/s1
Synonyms:- N-(1-Deoxy-D-fructos-1-yl)-L-phenylalanine
- fructose-phenylalanine
- Fructose-phenylalanine (Mixture of diastereoMers)
- 1-[(α-Carboxyphenethyl)aMino]-1-deoxy-fructose
- N-(1'-Carboxy-2'-phenylethyl)aMino-1-deoxyfructose
- (S)-1-[(1-Carboxy-2-phenylethyl)aMino]-1-deoxy-D-fructose
- L-Phenylalanine, N-(1-deoxy-D-fructos-1-yl)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fructose-phenylalanine (mixture of diastereomers)
CAS:Applications An Amadori compound having the potential to alter cellular adhesion, inhibit cancer metastasis and induce apoptosis.
References Horiuchi, T., et al.: Agric. Biol. Chem., 55, 333 (1991), Glinsky, G., et al.: Cancer Res., 56, 5319 (1996),Formula:C15H21NO7Color and Shape:NeatMolecular weight:327.33

