CAS 31105-90-5

3,4-Difluoro-L-phenylalanine

Description:

3,4-Difluoro-L-phenylalanine is an amino acid derivative characterized by the presence of two fluorine atoms substituted at the 3 and 4 positions of the phenyl ring of L-phenylalanine. This modification can influence the compound's biochemical properties, such as its hydrophobicity and interaction with biological targets. The presence of fluorine atoms often enhances the stability and metabolic resistance of the compound, making it of interest in medicinal chemistry and drug design. As a non-natural amino acid, it can be utilized in the synthesis of peptides and proteins, potentially altering their structure and function. The compound is typically white to off-white in appearance and is soluble in polar solvents. Its unique properties may also make it a valuable tool in studying protein folding, enzyme activity, and receptor interactions. However, the specific applications and effects of 3,4-Difluoro-L-phenylalanine depend on the context of its use in research or therapeutic settings.

Formula: C₉H₉F₂NO₂

InChI: InChI=1/C9H9F2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m0/s1

SMILES: c1cc(c(cc1C[C@@H](C(=O)O)N)F)F

Synonyms:

• L-3,4-Difluorophenylalanine

L-Phenylalanine, 3,4-difluoro-

CAS: 31105-90-5

Formula: C₉H₉F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.1701

Ref: IN-DA00324A

3,4-Difluoro-L-phenylalanine

CAS: 31105-90-5

3,4-Difluoro-L-phenylalanine

Purity: 97%

Color and Shape: Cream Solid

Molecular weight: 201.17g/mol

Ref: 54-PC8363

L-3,4-Difluorophenylalanine

CAS: 31105-90-5

Formula: C₉H₉F₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.173

Ref: 10-F049563