CAS 31129-95-0
:3-Hydroxybenzenepentanoic acid
Description:
3-Hydroxybenzenepentanoic acid, also known as 3-hydroxy-5-phenylpentanoic acid, is an organic compound characterized by its aromatic and aliphatic components. It features a hydroxyl group (-OH) attached to a benzene ring, which contributes to its polarity and potential for hydrogen bonding. The pentanoic acid moiety indicates a five-carbon straight-chain structure, which influences its solubility and reactivity. This compound is typically a white to off-white solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. Its chemical properties include the ability to participate in various reactions, such as esterification and oxidation, making it of interest in organic synthesis and pharmaceutical applications. Additionally, the presence of both hydrophilic and hydrophobic regions in its structure can lead to interesting interactions in biological systems, potentially influencing its behavior as a drug or biochemical agent. Overall, 3-Hydroxybenzenepentanoic acid is a versatile compound with applications in research and industry.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c12-10-6-3-5-9(8-10)4-1-2-7-11(13)14/h3,5-6,8,12H,1-2,4,7H2,(H,13,14)
InChI key:InChIKey=CMLIEOOXQFWANJ-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)C1=CC(O)=CC=C1
Synonyms:- Benzenepentanoic acid, 3-hydroxy-
- Valeric acid, 5-(m-hydroxyphenyl)-
- 3-Hydroxybenzenepentanoic acid
- 5-(3-Hydroxyphenyl)pentanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-(3-hydroxyphenyl)pentanoic Acid
CAS:<p>Applications 5-(3-hydroxyphenyl)pentanoic acid (cas# 31129-95-0) is a useful research chemical.<br></p>Formula:C11H14O3Color and Shape:NeatMolecular weight:194.235-(3-Hydroxyphenyl)pentanoic acid
CAS:<p>5-(3-Hydroxyphenyl)pentanoic acid (5HPP) is a fatty acid that has been isolated from the leaves of Cardunculus sp. and has shown pharmacological and nutritional properties. 5HPP has been shown to inhibit bacterial growth, which may be due to its ability to bind to bacterial DNA. 5HPP also binds to protein markers, such as methoxyphenol and phenolic, which are associated with antioxidant activity. 5HPP profiles have been determined using liquid chromatography in order to identify the major compounds in this phytochemical.</p>Formula:C11H14O3Purity:Min. 95%Molecular weight:194.23 g/mol


