CAS 31130-17-3

5-methyl-1,3,4-oxadiazole-2(3H)-thione

Description:

5-Methyl-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of an oxadiazole ring, which contains both nitrogen and oxygen atoms, along with a thione functional group. This compound typically exhibits a pale yellow to white crystalline appearance and is soluble in polar organic solvents. Its molecular structure includes a methyl group at the 5-position of the oxadiazole ring, which can influence its chemical reactivity and properties. The thione group contributes to its potential as a ligand in coordination chemistry and may exhibit biological activity, making it of interest in pharmaceutical research. The compound can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, due to the presence of the reactive thione sulfur atom. Additionally, it may display interesting thermal and spectral properties, which can be studied using techniques such as UV-Vis spectroscopy and NMR. Overall, 5-methyl-1,3,4-oxadiazole-2(3H)-thione is a versatile compound with potential applications in various fields of chemistry and materials science.

Formula: C₃H₄N₂OS

InChI: InChI=1/C3H4N2OS/c1-2-4-5-3(7)6-2/h1H3,(H,5,7)

InChI key: ZVGKPQCCKGLQPB-UHFFFAOYSA-N

SMILES: Cc1nnc(o1)S

Synonyms:

• 1,3,4-oxadiazole-2(3H)-thione, 5-methyl-
• 1,3,4-Oxadiazole-2-Thiol, 5-Methyl-
• 5-Methyl-[1,3,4]oxadiazole-2-thiol

5-Methyl-1,3,4-oxadiazole-2-thiol

CAS: 31130-17-3

5-Methyl-1,3,4-oxadiazole-2-thiol

Formula: C₃H₄N₂OS

Purity: 97%

Molecular weight: 116.14166

Ref: 54-OR965582

5-methyl-1,3,4-oxadiazole-2-thiol

CAS: 31130-17-3

Formula: C₃H₄N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 116.1417

Ref: IN-DA00BWUY

5-Methyl-1,3,4-oxadiazole-2-thiol

CAS: 31130-17-3

5-Methyl-1,3,4-oxadiazole-2-thiol is an inhibitor of the reductoisomerase enzyme. It has been shown to inhibit the growth of Brassica species, leading to a herbicidal effect. This compound also has a biological activity that inhibits the biosynthesis of methionine and threonine in bacteria.

Formula: C₃H₄N₂OS

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 116.14 g/mol

Ref: 3D-FM122919

5-methyl-1,3,4-oxadiazole-2-thiol

CAS: 31130-17-3

Formula: C₃H₄N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 116.14

Ref: 10-F391119