CAS 311313-26-5

1,3,4-Thiadiazole, 2-[4-(bromomethyl)phenyl]-5-(3-nitrophenyl)-

Description:

1,3,4-Thiadiazole, 2-[4-(bromomethyl)phenyl]-5-(3-nitrophenyl)- is a heterocyclic compound featuring a thiadiazole ring, which is a five-membered ring containing two nitrogen atoms and one sulfur atom. This compound is characterized by the presence of a bromomethyl group attached to a phenyl ring and a nitrophenyl substituent, contributing to its potential reactivity and biological activity. The bromomethyl group can serve as a site for further chemical modifications, while the nitro group may impart specific electronic properties. The compound's structure suggests it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Additionally, the presence of both electron-withdrawing (nitro) and electron-donating (bromomethyl) groups can influence its solubility, stability, and interaction with biological targets. As with many thiadiazole derivatives, this compound may also exhibit antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm such properties. Proper handling and safety measures should be observed due to the presence of bromine and nitro groups, which can pose health risks.

Formula: C₁₅H₁₀BrN₃O₂S

InChI: InChI=1S/C15H10BrN3O2S/c16-9-10-4-6-11(7-5-10)14-17-18-15(22-14)12-2-1-3-13(8-12)19(20)21/h1-8H,9H2

InChI key: UKZUVFXMUMFNJS-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)[N+](=O)[O-])C2=NN=C(S2)C3=CC=C(C=C3)CBr