CymitQuimica logo

CAS 31136-78-4

:

5-bromo-N-methylfuran-2-carboxamide

Description:
5-Bromo-N-methylfuran-2-carboxamide is a chemical compound characterized by its unique structure, which includes a furan ring, a bromine atom, and an amide functional group. The presence of the bromine atom introduces notable reactivity and can influence the compound's biological activity. The N-methyl group enhances the lipophilicity of the molecule, potentially affecting its solubility and interaction with biological systems. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Additionally, the furan moiety is known for its involvement in various chemical reactions, including electrophilic substitutions and cycloadditions. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 5-bromo-N-methylfuran-2-carboxamide is a versatile compound with significant implications in chemical research and development.
Formula:C6H6BrNO2
InChI:InChI=1/C6H6BrNO2/c1-8-6(9)4-2-3-5(7)10-4/h2-3H,1H3,(H,8,9)
InChI key:QMUCVHLODHSPLZ-UHFFFAOYSA-N
SMILES:CNC(=O)c1ccc(Br)o1
Found 1 products.